Welcome to Wuhan Kang-De-Li Chemical Co., Ltd.
Product category: | medical and biochemical engineering/bulk pharmaceutical chemicals/anti-inflammatory drug |
English name: | Benzyl benzoate |
CAS NO: | 120-51-4 |
Molecular weight: | 212.2439 |
EC NO: | 204-402-9 |
Molecular formula: | C14H12O2 |
InChI: | InChI=1/C14H12O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 |
Specifications: | content: 99% |
Packaging: | 220KG/drum |
Uses: | medical use |
Alias: | Benzoic acid benzyl ester; Ascabin; Ascabiol; Benylate; Benzyl alcohol benzoic ester; BENZOATO DE BENCILO; Benzoic acid phenylmethyl ester; Benzyl benzene carboxylate; Benzyl phenylformate; Phenylmethyl benzoate; Scabagen; Vanzoate; Benzyl benzoate BP |
Structural formula: |
Company name: Wuhan Kang-De-Li Chemical Co., Ltd.
Tel: +86-27-88185570 Mobile: +86-13807159350 Contact: Dai jun
Fax: +86-27-83213497 E-mail: xkchem@chemnet.com URL: www.kdlhg.cn
Add: No. 104, Gongnong Road, Qiaokou District, Wuhan City, Hubei Province, China