Welcome to Wuhan Kang-De-Li Chemical Co., Ltd.
Product category: | perfume and essence |
English name: | Benzyl acetate |
CAS NO: | 140-11-4 |
Molecular weight: | 150.1745 |
EC NO: | 205-399-7 |
Molecular formula: | C9H10O2 |
InChI: | InChI=1/C9H10O2/c1-8(10)11-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
Specifications: | content: 99% |
Packaging: | 200KG/drum |
Product introduction: | colorless liquid; contentPurity:≥99.0% boiling pointB.P.:199~200℃ acid value:≤1.0mgKOH/g specific gravity: D(25℃): 1.052~1.056 refractive index: n(20℃): 1.501~1.503 |
Uses: | perfume |
Alias: | Acetic acid benzyl ester; Benzyl ethanoate; ; 3-phenylpropanoate |
Structural formula: |
Company name: Wuhan Kang-De-Li Chemical Co., Ltd.
Tel: +86-27-88185570 Mobile: +86-13807159350 Contact: Dai jun
Fax: +86-27-83213497 E-mail: xkchem@chemnet.com URL: www.kdlhg.cn
Add: No. 104, Gongnong Road, Qiaokou District, Wuhan City, Hubei Province, China